C17H15ClIN5O — CID 90271347
5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-ethylphenyl)-4-iodo-1H-pyrrole-3-carboxamide (PubChem CID 90271347) has the molecular formula C17H15ClIN5O and a molecular weight of 467.70 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-ethylphenyl)-4-iodo-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-ethylphenyl)-4-iodo-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90271347 |
| Molecular Formula | C17H15ClIN5O |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-ethylphenyl)-4-iodo-1H-pyrrole-3-carboxamide |
| SMILES | CCc1ccc(Cl)cc1-c1[nH]c(-c2ccnc(N)n2)c(I)c1C(N)=O |
| InChI | InChI=1S/C17H15ClIN5O/c1-2-8-3-4-9(18)7-10(8)14-12(16(20)25)13(19)15(24-14)11-5-6-22-17(21)23-11/h3-7,24H,2H2,1H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | UUIIORWTIROASH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|