C18H18ClN5O — CID 66571378
5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-methylphenyl)-1-ethylpyrrole-3-carboxamide (PubChem CID 66571378) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-methylphenyl)-1-ethylpyrrole-3-carboxamide.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-methylphenyl)-1-ethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 66571378 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-2-(5-chloro-2-methylphenyl)-1-ethylpyrrole-3-carboxamide |
| SMILES | CCn1c(-c2ccnc(N)n2)cc(C(N)=O)c1-c1cc(Cl)ccc1C |
| InChI | InChI=1S/C18H18ClN5O/c1-3-24-15(14-6-7-22-18(21)23-14)9-13(17(20)25)16(24)12-8-11(19)5-4-10(12)2/h4-9H,3H2,1-2H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | GPSCMUMAFNLGBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |