C10H8N4 — CID 139215807
4H-[1,3,5]triazino[2,1-b]quinazoline (PubChem CID 139215807) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4H-[1,3,5]triazino[2,1-b]quinazoline.
| Compound Name | 4H-[1,3,5]triazino[2,1-b]quinazoline |
|---|---|
| PubChem CID | 139215807 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4H-[1,3,5]triazino[2,1-b]quinazoline |
| SMILES | C1=NCN2C=c3ccccc3=NC2=N1 |
| InChI | InChI=1S/C10H8N4/c1-2-4-9-8(3-1)5-14-7-11-6-12-10(14)13-9/h1-6H,7H2 |
| InChIKey | FPFQRQHTRZSHDT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |