C29H20N4+4 — CID 20756022
1,9,17,25-tetrazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene (PubChem CID 20756022) has the molecular formula C29H20N4+4 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1,9,17,25-tetrazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene.
| Compound Name | 1,9,17,25-tetrazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
|---|---|
| PubChem CID | 20756022 |
| Molecular Formula | C29H20N4+4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1,9,17,25-tetrazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
| SMILES | C1=c2ccccc2=[N+]2C=c3ccccc3=[N+]3C=c4ccccc4=[N+]4C=c5ccccc5=[N+]1C243 |
| InChI | InChI=1S/C29H20N4/c1-5-13-25-21(9-1)17-30-26-14-6-2-11-23(26)19-32-28-16-8-4-12-24(28)20-33-27-15-7-3-10-22(27)18-31(25)29(30,32)33/h1-20H/q+4 |
| InChIKey | UIFSNRSNEXFKKJ-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 12.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|