C30H20N3+3 — CID 59348363
1,9,17-triazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene (PubChem CID 59348363) has the molecular formula C30H20N3+3 and a molecular weight of 422.51 g/mol. Its IUPAC name is 1,9,17-triazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene.
| Compound Name | 1,9,17-triazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
|---|---|
| PubChem CID | 59348363 |
| Molecular Formula | C30H20N3+3 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1,9,17-triazoniaoctacyclo[15.15.1.02,7.09,33.010,15.018,23.025,33.026,31]tritriaconta-1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31-hexadecaene |
| SMILES | C1=c2ccccc2=C2C=c3ccccc3=[N+]3C=c4ccccc4=[N+]4C=c5ccccc5=[N+]1C234 |
| InChI | InChI=1S/C30H20N3/c1-5-13-25-22(10-1)18-31-28-15-7-3-12-24(28)20-33-29-16-8-4-11-23(29)19-32-27-14-6-2-9-21(27)17-26(25)30(31,32)33/h1-20H/q+3 |
| InChIKey | AHMWTWHILQTBCI-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|