C16H12N2 — CID 154258634
2,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1,3,5,9,11,13,15,17-octaene (PubChem CID 154258634) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 2,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1,3,5,9,11,13,15,17-octaene.
| Compound Name | 2,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1,3,5,9,11,13,15,17-octaene |
|---|---|
| PubChem CID | 154258634 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2,8-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1,3,5,9,11,13,15,17-octaene |
| SMILES | C1=CCN2C=c3cc4ccccc4cc3=NC2=C1 |
| InChI | InChI=1S/C16H12N2/c1-2-6-13-10-15-14(9-12(13)5-1)11-18-8-4-3-7-16(18)17-15/h1-7,9-11H,8H2 |
| InChIKey | MUHHKYSKRHDNBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |