C13H12N4Se — CID 139215941
4-N-benzyl-2,1,3-benzoselenadiazole-4,5-diamine (PubChem CID 139215941) has the molecular formula C13H12N4Se and a molecular weight of 303.23 g/mol. Its IUPAC name is 4-N-benzyl-2,1,3-benzoselenadiazole-4,5-diamine.
| Compound Name | 4-N-benzyl-2,1,3-benzoselenadiazole-4,5-diamine |
|---|---|
| PubChem CID | 139215941 |
| Molecular Formula | C13H12N4Se |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-N-benzyl-2,1,3-benzoselenadiazole-4,5-diamine |
| SMILES | Nc1ccc2n[se]nc2c1NCc1ccccc1 |
| InChI | InChI=1S/C13H12N4Se/c14-10-6-7-11-13(17-18-16-11)12(10)15-8-9-4-2-1-3-5-9/h1-7,15H,8,14H2 |
| InChIKey | OCNFLWKHWOFPBJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|