C20H10F3N7O2 — CID 139220102
7-(3-nitrophenyl)-11-phenyl-13-(trifluoromethyl)-3,4,5,6,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 139220102) has the molecular formula C20H10F3N7O2 and a molecular weight of 437.34 g/mol. Its IUPAC name is 7-(3-nitrophenyl)-11-phenyl-13-(trifluoromethyl)-3,4,5,6,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 7-(3-nitrophenyl)-11-phenyl-13-(trifluoromethyl)-3,4,5,6,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 139220102 |
| Molecular Formula | C20H10F3N7O2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 7-(3-nitrophenyl)-11-phenyl-13-(trifluoromethyl)-3,4,5,6,8,10-hexazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3nc(-c4ccccc4)cc(C(F)(F)F)c3c3nnnn23)c1 |
| InChI | InChI=1S/C20H10F3N7O2/c21-20(22,23)14-10-15(11-5-2-1-3-6-11)24-17-16(14)19-26-27-28-29(19)18(25-17)12-7-4-8-13(9-12)30(31)32/h1-10H |
| InChIKey | UQNBUSHDEUOKQG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|