C22H25N3O5 — CID 139221272
6-amino-5-[cyclohexyl-(4-hydroxy-2-oxochromen-3-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 139221272) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 6-amino-5-[cyclohexyl-(4-hydroxy-2-oxochromen-3-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[cyclohexyl-(4-hydroxy-2-oxochromen-3-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139221272 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 6-amino-5-[cyclohexyl-(4-hydroxy-2-oxochromen-3-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(N)c(C(c2c(O)c3ccccc3oc2=O)C2CCCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H25N3O5/c1-24-19(23)17(20(27)25(2)22(24)29)15(12-8-4-3-5-9-12)16-18(26)13-10-6-7-11-14(13)30-21(16)28/h6-7,10-12,15,26H,3-5,8-9,23H2,1-2H3 |
| InChIKey | QWFKULQFCLCEGN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|