C22H18N4O8 — CID 102231641
11-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-14,16-dimethyl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13,15-trione (PubChem CID 102231641) has the molecular formula C22H18N4O8 and a molecular weight of 466.41 g/mol. Its IUPAC name is 11-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-14,16-dimethyl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13,15-trione.
| Compound Name | 11-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-14,16-dimethyl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13,15-trione |
|---|---|
| PubChem CID | 102231641 |
| Molecular Formula | C22H18N4O8 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 11-(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-14,16-dimethyl-8,18-dioxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,12(17)-pentaene-9,13,15-trione |
| SMILES | Cn1c(O)c(C2c3c(c4ccccc4oc3=O)Oc3c2c(=O)n(C)c(=O)n3C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H18N4O8/c1-23-16(27)13(17(28)24(2)21(23)31)11-12-15(9-7-5-6-8-10(9)33-20(12)30)34-19-14(11)18(29)25(3)22(32)26(19)4/h5-8,11,27H,1-4H3 |
| InChIKey | SWMBIMYUPUCXFA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|