About CID 139221499
CID 139221499 (PubChem CID 139221499) has the molecular formula C15H14NO
and a molecular weight of 224.28 g/mol.
Molecular Properties
| Compound Name | CID 139221499 |
| PubChem CID | 139221499 |
| Molecular Formula | C15H14NO |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | — |
| SMILES | COc1ccc(N2[CH]c3ccccc3C2)cc1 |
| InChI | InChI=1S/C15H14NO/c1-17-15-8-6-14(7-9-15)16-10-12-4-2-3-5-13(12)11-16/h2-10H,11H2,1H3 |
| InChIKey | SLHGLIAJPSFDDK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 139221499 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139221499?
The IUPAC name of CID 139221499 (CID 139221499) is not available.
What is the SMILES notation for CID 139221499?
The canonical SMILES for CID 139221499 is COc1ccc(N2[CH]c3ccccc3C2)cc1.
What is the InChIKey of CID 139221499?
The InChIKey is SLHGLIAJPSFDDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14NO/c1-17-15-8-6-14(7-9-15)16-10-12-4-2-3-5-13(12)11-16/h2-10H,11H2,1H3.
What are the key properties of CID 139221499?
CID 139221499 has a molecular weight of 224.28 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139221499 is sourced from PubChem (CID 139221499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).