C12H11F3N4O3S — CID 139222752
(E)-1-(2-methoxyphenyl)-N-[3-methylsulfonyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]methanimine (PubChem CID 139222752) has the molecular formula C12H11F3N4O3S and a molecular weight of 348.31 g/mol. Its IUPAC name is (E)-1-(2-methoxyphenyl)-N-[3-methylsulfonyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]methanimine.
| Compound Name | (E)-1-(2-methoxyphenyl)-N-[3-methylsulfonyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 139222752 |
| Molecular Formula | C12H11F3N4O3S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (E)-1-(2-methoxyphenyl)-N-[3-methylsulfonyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]methanimine |
| SMILES | COc1ccccc1/C=N/n1c(C(F)(F)F)nnc1S(C)(=O)=O |
| InChI | InChI=1S/C12H11F3N4O3S/c1-22-9-6-4-3-5-8(9)7-16-19-10(12(13,14)15)17-18-11(19)23(2,20)21/h3-7H,1-2H3/b16-7+ |
| InChIKey | OPMMIUNZCILJLP-FRKPEAEDSA-N |
| XLogP | 1.59 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|