C34H22O11 — CID 139223174
[3,9-bis[(8-hydroxy-2-oxochromen-4-yl)methyl]-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate (PubChem CID 139223174) has the molecular formula C34H22O11 and a molecular weight of 606.54 g/mol. Its IUPAC name is [3,9-bis[(8-hydroxy-2-oxochromen-4-yl)methyl]-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate.
| Compound Name | [3,9-bis[(8-hydroxy-2-oxochromen-4-yl)methyl]-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate |
|---|---|
| PubChem CID | 139223174 |
| Molecular Formula | C34H22O11 |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | [3,9-bis[(8-hydroxy-2-oxochromen-4-yl)methyl]-2-oxo-5H-pyrano[3,2-c]chromen-5-yl] acetate |
| SMILES | CC(=O)OC1Oc2ccc(Cc3cc(=O)oc4c(O)cccc34)cc2-c2oc(=O)c(Cc3cc(=O)oc4c(O)cccc34)cc21 |
| InChI | InChI=1S/C34H22O11/c1-16(35)41-34-24-13-20(12-19-15-29(39)44-32-22(19)5-3-7-26(32)37)33(40)45-30(24)23-11-17(8-9-27(23)42-34)10-18-14-28(38)43-31-21(18)4-2-6-25(31)36/h2-9,11,13-15,34,36-37H,10,12H2,1H3 |
| InChIKey | HIIGVXGXWOTSHI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|