C25H18O6 — CID 25108248
3-(7-methyl-2-oxochromen-4-yl)-5-prop-2-enoxy-5H-pyrano[3,2-c]chromen-2-one (PubChem CID 25108248) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is 3-(7-methyl-2-oxochromen-4-yl)-5-prop-2-enoxy-5H-pyrano[3,2-c]chromen-2-one.
| Compound Name | 3-(7-methyl-2-oxochromen-4-yl)-5-prop-2-enoxy-5H-pyrano[3,2-c]chromen-2-one |
|---|---|
| PubChem CID | 25108248 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-(7-methyl-2-oxochromen-4-yl)-5-prop-2-enoxy-5H-pyrano[3,2-c]chromen-2-one |
| SMILES | C=CCOC1Oc2ccccc2-c2oc(=O)c(-c3cc(=O)oc4cc(C)ccc34)cc21 |
| InChI | InChI=1S/C25H18O6/c1-3-10-28-25-19-12-18(17-13-22(26)29-21-11-14(2)8-9-15(17)21)24(27)31-23(19)16-6-4-5-7-20(16)30-25/h3-9,11-13,25H,1,10H2,2H3 |
| InChIKey | VOHVYYOXXZKMHQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|