C18H12O4 — CID 135027990
6-ethenyl-10-hydroxy-6H-chromeno[4,3-b]chromen-7-one (PubChem CID 135027990) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 6-ethenyl-10-hydroxy-6H-chromeno[4,3-b]chromen-7-one.
| Compound Name | 6-ethenyl-10-hydroxy-6H-chromeno[4,3-b]chromen-7-one |
|---|---|
| PubChem CID | 135027990 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-ethenyl-10-hydroxy-6H-chromeno[4,3-b]chromen-7-one |
| SMILES | C=CC1Oc2ccccc2-c2oc3cc(O)ccc3c(=O)c21 |
| InChI | InChI=1S/C18H12O4/c1-2-13-16-17(20)11-8-7-10(19)9-15(11)22-18(16)12-5-3-4-6-14(12)21-13/h2-9,13,19H,1H2 |
| InChIKey | WMUUXDZTGKJBIG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|