C25H20O6 — CID 25108252
5-ethoxy-9-methyl-3-(7-methyl-2-oxochromen-4-yl)-5H-pyrano[3,2-c]chromen-2-one (PubChem CID 25108252) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is 5-ethoxy-9-methyl-3-(7-methyl-2-oxochromen-4-yl)-5H-pyrano[3,2-c]chromen-2-one.
| Compound Name | 5-ethoxy-9-methyl-3-(7-methyl-2-oxochromen-4-yl)-5H-pyrano[3,2-c]chromen-2-one |
|---|---|
| PubChem CID | 25108252 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 5-ethoxy-9-methyl-3-(7-methyl-2-oxochromen-4-yl)-5H-pyrano[3,2-c]chromen-2-one |
| SMILES | CCOC1Oc2ccc(C)cc2-c2oc(=O)c(-c3cc(=O)oc4cc(C)ccc34)cc21 |
| InChI | InChI=1S/C25H20O6/c1-4-28-25-19-11-17(16-12-22(26)29-21-10-14(3)5-7-15(16)21)24(27)31-23(19)18-9-13(2)6-8-20(18)30-25/h5-12,25H,4H2,1-3H3 |
| InChIKey | WCGCWIVDOKSMEE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|