C24H18O6 — CID 25108312
5-ethoxy-3-(6-methyl-2-oxochromen-4-yl)-10aH-pyrano[2,3-b]chromen-2-one (PubChem CID 25108312) has the molecular formula C24H18O6 and a molecular weight of 402.40 g/mol. Its IUPAC name is 5-ethoxy-3-(6-methyl-2-oxochromen-4-yl)-10aH-pyrano[2,3-b]chromen-2-one.
| Compound Name | 5-ethoxy-3-(6-methyl-2-oxochromen-4-yl)-10aH-pyrano[2,3-b]chromen-2-one |
|---|---|
| PubChem CID | 25108312 |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-ethoxy-3-(6-methyl-2-oxochromen-4-yl)-10aH-pyrano[2,3-b]chromen-2-one |
| SMILES | CCOC1=C2C=C(c3cc(=O)oc4ccc(C)cc34)C(=O)OC2Oc2ccccc21 |
| InChI | InChI=1S/C24H18O6/c1-3-27-22-14-6-4-5-7-19(14)29-24-18(22)11-17(23(26)30-24)15-12-21(25)28-20-9-8-13(2)10-16(15)20/h4-12,24H,3H2,1-2H3 |
| InChIKey | QUICHJOBVAYSNL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|