C18H12O8 — CID 163028342
[(6S)-9,10,11-trihydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] acetate (PubChem CID 163028342) has the molecular formula C18H12O8 and a molecular weight of 356.29 g/mol. Its IUPAC name is [(6S)-9,10,11-trihydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] acetate.
| Compound Name | [(6S)-9,10,11-trihydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] acetate |
|---|---|
| PubChem CID | 163028342 |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [(6S)-9,10,11-trihydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1Oc2ccccc2-c2c1oc1cc(O)c(O)c(O)c1c2=O |
| InChI | InChI=1S/C18H12O8/c1-7(19)24-18-17-12(8-4-2-3-5-10(8)26-18)15(22)13-11(25-17)6-9(20)14(21)16(13)23/h2-6,18,20-21,23H,1H3/t18-/m1/s1 |
| InChIKey | IFAQBCFCOHMCTL-GOSISDBHSA-N |
| XLogP | 2.53 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|