C31H30N2O6 — CID 139223432
N-tert-butyl-2-(N-[2-(4-methoxyphenyl)-2-oxoacetyl]anilino)-2-(6-methyl-4-oxochromen-3-yl)acetamide (PubChem CID 139223432) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is N-tert-butyl-2-(N-[2-(4-methoxyphenyl)-2-oxoacetyl]anilino)-2-(6-methyl-4-oxochromen-3-yl)acetamide.
| Compound Name | N-tert-butyl-2-(N-[2-(4-methoxyphenyl)-2-oxoacetyl]anilino)-2-(6-methyl-4-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 139223432 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N-tert-butyl-2-(N-[2-(4-methoxyphenyl)-2-oxoacetyl]anilino)-2-(6-methyl-4-oxochromen-3-yl)acetamide |
| SMILES | COc1ccc(C(=O)C(=O)N(c2ccccc2)C(C(=O)NC(C)(C)C)c2coc3ccc(C)cc3c2=O)cc1 |
| InChI | InChI=1S/C31H30N2O6/c1-19-11-16-25-23(17-19)28(35)24(18-39-25)26(29(36)32-31(2,3)4)33(21-9-7-6-8-10-21)30(37)27(34)20-12-14-22(38-5)15-13-20/h6-18,26H,1-5H3,(H,32,36) |
| InChIKey | PALNNRMJIFLOKB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|