C32H33N3O5 — CID 139223502
2-N-tert-butyl-1-N,1-N-bis(4-methylphenyl)-2-(4-oxochromen-3-yl)ethane-1,1,2-tricarboxamide (PubChem CID 139223502) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-N-tert-butyl-1-N,1-N-bis(4-methylphenyl)-2-(4-oxochromen-3-yl)ethane-1,1,2-tricarboxamide.
| Compound Name | 2-N-tert-butyl-1-N,1-N-bis(4-methylphenyl)-2-(4-oxochromen-3-yl)ethane-1,1,2-tricarboxamide |
|---|---|
| PubChem CID | 139223502 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-N-tert-butyl-1-N,1-N-bis(4-methylphenyl)-2-(4-oxochromen-3-yl)ethane-1,1,2-tricarboxamide |
| SMILES | Cc1ccc(NC(=O)C(C(=O)Nc2ccc(C)cc2)C(C(=O)NC(C)(C)C)c2coc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C32H33N3O5/c1-19-10-14-21(15-11-19)33-29(37)27(30(38)34-22-16-12-20(2)13-17-22)26(31(39)35-32(3,4)5)24-18-40-25-9-7-6-8-23(25)28(24)36/h6-18,26-27H,1-5H3,(H,33,37)(H,34,38)(H,35,39) |
| InChIKey | JHHNOUIQBNHUHX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|