C30H29N3O5 — CID 139223501
2-N-tert-butyl-2-(4-oxochromen-3-yl)-1-N,1-N-diphenylethane-1,1,2-tricarboxamide (PubChem CID 139223501) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-N-tert-butyl-2-(4-oxochromen-3-yl)-1-N,1-N-diphenylethane-1,1,2-tricarboxamide.
| Compound Name | 2-N-tert-butyl-2-(4-oxochromen-3-yl)-1-N,1-N-diphenylethane-1,1,2-tricarboxamide |
|---|---|
| PubChem CID | 139223501 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-N-tert-butyl-2-(4-oxochromen-3-yl)-1-N,1-N-diphenylethane-1,1,2-tricarboxamide |
| SMILES | CC(C)(C)NC(=O)C(c1coc2ccccc2c1=O)C(C(=O)Nc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H29N3O5/c1-30(2,3)33-29(37)24(22-18-38-23-17-11-10-16-21(23)26(22)34)25(27(35)31-19-12-6-4-7-13-19)28(36)32-20-14-8-5-9-15-20/h4-18,24-25H,1-3H3,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | MTKKVLSGEDWZIO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|