C29H33NO10 — CID 139223896
tetramethyl 10-(tert-butylamino)-11-oxo-2-propan-2-yl-9H-cyclohepta[b]chromene-6,7,8,9-tetracarboxylate (PubChem CID 139223896) has the molecular formula C29H33NO10 and a molecular weight of 555.58 g/mol. Its IUPAC name is tetramethyl 10-(tert-butylamino)-11-oxo-2-propan-2-yl-9H-cyclohepta[b]chromene-6,7,8,9-tetracarboxylate.
| Compound Name | tetramethyl 10-(tert-butylamino)-11-oxo-2-propan-2-yl-9H-cyclohepta[b]chromene-6,7,8,9-tetracarboxylate |
|---|---|
| PubChem CID | 139223896 |
| Molecular Formula | C29H33NO10 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | tetramethyl 10-(tert-butylamino)-11-oxo-2-propan-2-yl-9H-cyclohepta[b]chromene-6,7,8,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)C(NC(C)(C)C)=c2c(oc3ccc(C(C)C)cc3c2=O)=C1C(=O)OC |
| InChI | InChI=1S/C29H33NO10/c1-13(2)14-10-11-16-15(12-14)23(31)21-22(30-29(3,4)5)19(27(34)38-8)17(25(32)36-6)18(26(33)37-7)20(24(21)40-16)28(35)39-9/h10-13,19,30H,1-9H3 |
| InChIKey | SRDWUKSTBOYFGP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|