C11H7Br2N3O3S — CID 139226565
[(E)-(6,8-dibromo-7-hydroxy-4-oxochromen-3-yl)methylideneamino]thiourea (PubChem CID 139226565) has the molecular formula C11H7Br2N3O3S and a molecular weight of 421.07 g/mol. Its IUPAC name is [(E)-(6,8-dibromo-7-hydroxy-4-oxochromen-3-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(6,8-dibromo-7-hydroxy-4-oxochromen-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 139226565 |
| Molecular Formula | C11H7Br2N3O3S |
| Molecular Weight | 421.07 g/mol |
| Exact Mass | 418.86 |
| IUPAC Name | [(E)-(6,8-dibromo-7-hydroxy-4-oxochromen-3-yl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1coc2c(Br)c(O)c(Br)cc2c1=O |
| InChI | InChI=1S/C11H7Br2N3O3S/c12-6-1-5-8(17)4(2-15-16-11(14)20)3-19-10(5)7(13)9(6)18/h1-3,18H,(H3,14,16,20)/b15-2+ |
| InChIKey | MQNOXBRUOJVPIE-RSSMCMFDSA-N |
| XLogP | 2.19 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|