C24H22F3NO5S — CID 139228815
4-(1,3-benzodioxol-5-yl)-2-hydroxy-7,7-dimethyl-3-(thiophene-2-carbonyl)-2-(trifluoromethyl)-3,4,6,8-tetrahydro-1H-quinolin-5-one (PubChem CID 139228815) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-hydroxy-7,7-dimethyl-3-(thiophene-2-carbonyl)-2-(trifluoromethyl)-3,4,6,8-tetrahydro-1H-quinolin-5-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-hydroxy-7,7-dimethyl-3-(thiophene-2-carbonyl)-2-(trifluoromethyl)-3,4,6,8-tetrahydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 139228815 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-hydroxy-7,7-dimethyl-3-(thiophene-2-carbonyl)-2-(trifluoromethyl)-3,4,6,8-tetrahydro-1H-quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(O)(C(F)(F)F)C(C(=O)c1cccs1)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H22F3NO5S/c1-22(2)9-13-19(14(29)10-22)18(12-5-6-15-16(8-12)33-11-32-15)20(21(30)17-4-3-7-34-17)23(31,28-13)24(25,26)27/h3-8,18,20,28,31H,9-11H2,1-2H3 |
| InChIKey | QAMMYKDBYVFAHK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |