C18H18N2O3 — CID 139229623
5-methylspiro[7,8-dihydro-6H-cyclohepta[b]indole-9,3'-piperidine]-2',6',10-trione (PubChem CID 139229623) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-methylspiro[7,8-dihydro-6H-cyclohepta[b]indole-9,3'-piperidine]-2',6',10-trione.
| Compound Name | 5-methylspiro[7,8-dihydro-6H-cyclohepta[b]indole-9,3'-piperidine]-2',6',10-trione |
|---|---|
| PubChem CID | 139229623 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-methylspiro[7,8-dihydro-6H-cyclohepta[b]indole-9,3'-piperidine]-2',6',10-trione |
| SMILES | Cn1c2c(c3ccccc31)C(=O)C1(CCC2)CCC(=O)NC1=O |
| InChI | InChI=1S/C18H18N2O3/c1-20-12-6-3-2-5-11(12)15-13(20)7-4-9-18(16(15)22)10-8-14(21)19-17(18)23/h2-3,5-6H,4,7-10H2,1H3,(H,19,21,23) |
| InChIKey | AKZUXFKPNUAOOB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|