C16H14N2O3 — CID 139229615
4-methylspiro[1H-cyclopenta[b]indole-2,3'-piperidine]-2',3,6'-trione (PubChem CID 139229615) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-methylspiro[1H-cyclopenta[b]indole-2,3'-piperidine]-2',3,6'-trione.
| Compound Name | 4-methylspiro[1H-cyclopenta[b]indole-2,3'-piperidine]-2',3,6'-trione |
|---|---|
| PubChem CID | 139229615 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-methylspiro[1H-cyclopenta[b]indole-2,3'-piperidine]-2',3,6'-trione |
| SMILES | Cn1c2c(c3ccccc31)CC1(CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C16H14N2O3/c1-18-11-5-3-2-4-9(11)10-8-16(14(20)13(10)18)7-6-12(19)17-15(16)21/h2-5H,6-8H2,1H3,(H,17,19,21) |
| InChIKey | QGUNMWCBPQNWSA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|