C15H13N3O — CID 102451719
11-methyl-3,4-dihydro-1H-indolo[3,2-h][1,5]naphthyridin-2-one (PubChem CID 102451719) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 11-methyl-3,4-dihydro-1H-indolo[3,2-h][1,5]naphthyridin-2-one.
| Compound Name | 11-methyl-3,4-dihydro-1H-indolo[3,2-h][1,5]naphthyridin-2-one |
|---|---|
| PubChem CID | 102451719 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 11-methyl-3,4-dihydro-1H-indolo[3,2-h][1,5]naphthyridin-2-one |
| SMILES | Cn1c2ccccc2c2cnc3c(c21)NC(=O)CC3 |
| InChI | InChI=1S/C15H13N3O/c1-18-12-5-3-2-4-9(12)10-8-16-11-6-7-13(19)17-14(11)15(10)18/h2-5,8H,6-7H2,1H3,(H,17,19) |
| InChIKey | XKTNDFYWRWLOLD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |