C24H26N8OS — CID 139229723
5-[4-[4-(4-phenylpiperazin-1-yl)quinazolin-2-yl]piperazin-1-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 139229723) has the molecular formula C24H26N8OS and a molecular weight of 474.59 g/mol. Its IUPAC name is 5-[4-[4-(4-phenylpiperazin-1-yl)quinazolin-2-yl]piperazin-1-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[4-[4-(4-phenylpiperazin-1-yl)quinazolin-2-yl]piperazin-1-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 139229723 |
| Molecular Formula | C24H26N8OS |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 5-[4-[4-(4-phenylpiperazin-1-yl)quinazolin-2-yl]piperazin-1-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(N2CCN(c3nc(N4CCN(c5ccccc5)CC4)c4ccccc4n3)CC2)o1 |
| InChI | InChI=1S/C24H26N8OS/c34-24-28-27-23(33-24)32-16-14-31(15-17-32)22-25-20-9-5-4-8-19(20)21(26-22)30-12-10-29(11-13-30)18-6-2-1-3-7-18/h1-9H,10-17H2,(H,28,34) |
| InChIKey | UGJOWRAHMVDBJA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|