C17H17NO3 — CID 139229832
2-cyclohexyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 139229832) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-cyclohexyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-cyclohexyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 139229832 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-cyclohexyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccccc3c(=O)c2CN1C1CCCCC1 |
| InChI | InChI=1S/C17H17NO3/c19-15-12-8-4-5-9-14(12)21-16-13(15)10-18(17(16)20)11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2 |
| InChIKey | BIJZSSFCEDIHND-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |