C18H13NO3 — CID 7379009
(1S)-2-methyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 7379009) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is (1S)-2-methyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-2-methyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 7379009 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (1S)-2-methyl-1-phenyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CN1C(=O)c2oc3ccccc3c(=O)c2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H13NO3/c1-19-15(11-7-3-2-4-8-11)14-16(20)12-9-5-6-10-13(12)22-17(14)18(19)21/h2-10,15H,1H3/t15-/m0/s1 |
| InChIKey | ISKLASWBHNTKQZ-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |