C12H11BrN4O5 — CID 139230096
4-(bromomethyl)-3-methyl-5-nitro-6-(3-nitrophenyl)-1,6-dihydropyrimidin-2-one (PubChem CID 139230096) has the molecular formula C12H11BrN4O5 and a molecular weight of 371.15 g/mol. Its IUPAC name is 4-(bromomethyl)-3-methyl-5-nitro-6-(3-nitrophenyl)-1,6-dihydropyrimidin-2-one.
| Compound Name | 4-(bromomethyl)-3-methyl-5-nitro-6-(3-nitrophenyl)-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 139230096 |
| Molecular Formula | C12H11BrN4O5 |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 4-(bromomethyl)-3-methyl-5-nitro-6-(3-nitrophenyl)-1,6-dihydropyrimidin-2-one |
| SMILES | CN1C(=O)NC(c2cccc([N+](=O)[O-])c2)C([N+](=O)[O-])=C1CBr |
| InChI | InChI=1S/C12H11BrN4O5/c1-15-9(6-13)11(17(21)22)10(14-12(15)18)7-3-2-4-8(5-7)16(19)20/h2-5,10H,6H2,1H3,(H,14,18) |
| InChIKey | MURCNKNJUUOXIN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|