C14H15N5O5 — CID 7036346
(4S)-6-[(E)-2-(dimethylamino)ethenyl]-5-nitro-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 7036346) has the molecular formula C14H15N5O5 and a molecular weight of 333.30 g/mol. Its IUPAC name is (4S)-6-[(E)-2-(dimethylamino)ethenyl]-5-nitro-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-6-[(E)-2-(dimethylamino)ethenyl]-5-nitro-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 7036346 |
| Molecular Formula | C14H15N5O5 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (4S)-6-[(E)-2-(dimethylamino)ethenyl]-5-nitro-4-(3-nitrophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CN(C)/C=C/C1=C([N+](=O)[O-])[C@H](c2cccc([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C14H15N5O5/c1-17(2)7-6-11-13(19(23)24)12(16-14(20)15-11)9-4-3-5-10(8-9)18(21)22/h3-8,12H,1-2H3,(H2,15,16,20)/b7-6+/t12-/m0/s1 |
| InChIKey | DUEXZWMRFDSPRW-SYTKJHMZSA-N |
| XLogP | 1.51 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|