C20H24N4O2S2 — CID 139230210
N-[4-[2-[2-(2-adamantylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]methanesulfonamide (PubChem CID 139230210) has the molecular formula C20H24N4O2S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[4-[2-[2-(2-adamantylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[2-(2-adamantylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 139230210 |
| Molecular Formula | C20H24N4O2S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[4-[2-[2-(2-adamantylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(NN=C3C4CC5CC(C4)CC3C5)n2)cc1 |
| InChI | InChI=1S/C20H24N4O2S2/c1-28(25,26)24-17-4-2-14(3-5-17)18-11-27-20(21-18)23-22-19-15-7-12-6-13(9-15)10-16(19)8-12/h2-5,11-13,15-16,24H,6-10H2,1H3,(H,21,23)/b22-19- |
| InChIKey | NIOYJIURBHFDPE-QOCHGBHMSA-N |
| XLogP | 4.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|