C21H26BrN3S — CID 171114693
N-(2-adamantylideneamino)-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide (PubChem CID 171114693) has the molecular formula C21H26BrN3S and a molecular weight of 432.43 g/mol. Its IUPAC name is N-(2-adamantylideneamino)-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | N-(2-adamantylideneamino)-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 171114693 |
| Molecular Formula | C21H26BrN3S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-(2-adamantylideneamino)-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1ccc(-c2csc(NN=C3C4CC5CC(C4)CC3C5)n2)cc1C |
| InChI | InChI=1S/C21H25N3S.BrH/c1-12-3-4-16(5-13(12)2)19-11-25-21(22-19)24-23-20-17-7-14-6-15(9-17)10-18(20)8-14;/h3-5,11,14-15,17-18H,6-10H2,1-2H3,(H,22,24);1H/b23-20-; |
| InChIKey | VWABFHXYEQALGX-QTXBERLJSA-N |
| XLogP | 6.23 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|