C17H22N4O4 — CID 139230238
diethyl 2-[[2-(1-phenyl-4,5-dihydroimidazol-2-yl)hydrazinyl]methylidene]propanedioate (PubChem CID 139230238) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is diethyl 2-[[2-(1-phenyl-4,5-dihydroimidazol-2-yl)hydrazinyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-(1-phenyl-4,5-dihydroimidazol-2-yl)hydrazinyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 139230238 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | diethyl 2-[[2-(1-phenyl-4,5-dihydroimidazol-2-yl)hydrazinyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNNC1=NCCN1c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C17H22N4O4/c1-3-24-15(22)14(16(23)25-4-2)12-19-20-17-18-10-11-21(17)13-8-6-5-7-9-13/h5-9,12,19H,3-4,10-11H2,1-2H3,(H,18,20) |
| InChIKey | PAWILBASLAITCD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|