C19H23N3O4S — CID 12892056
diethyl 2-[[(6-ethyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate (PubChem CID 12892056) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is diethyl 2-[[(6-ethyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(6-ethyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 12892056 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | diethyl 2-[[(6-ethyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazol-7-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cc2c(cc1CC)SC1=NCCN12)C(=O)OCC |
| InChI | InChI=1S/C19H23N3O4S/c1-4-12-9-16-15(22-8-7-20-19(22)27-16)10-14(12)21-11-13(17(23)25-5-2)18(24)26-6-3/h9-11,21H,4-8H2,1-3H3 |
| InChIKey | NMLMNNQAYYNOGX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|