C27H18F3N7O4 — CID 139231964
3-(furan-2-ylmethyl)-1-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-5-phenyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one (PubChem CID 139231964) has the molecular formula C27H18F3N7O4 and a molecular weight of 561.48 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-5-phenyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(furan-2-ylmethyl)-1-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-5-phenyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 139231964 |
| Molecular Formula | C27H18F3N7O4 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-5-phenyl-7-(trifluoromethyl)imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1n(Cc2ccco2)c2nc(-c3ccccc3)cc(C(F)(F)F)c2n1Cc1cn(-c2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C27H18F3N7O4/c28-27(29,30)22-13-23(17-5-2-1-3-6-17)31-25-24(22)34(26(38)35(25)16-21-7-4-12-41-21)14-18-15-36(33-32-18)19-8-10-20(11-9-19)37(39)40/h1-13,15H,14,16H2 |
| InChIKey | IWFBGKBQRNJMCM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 126.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|