C27H17N5O4 — CID 71600100
N-(2,5-diphenylpyrazolo[4,3-d]pyrimidin-7-yl)-N-(furan-2-carbonyl)furan-2-carboxamide (PubChem CID 71600100) has the molecular formula C27H17N5O4 and a molecular weight of 475.46 g/mol. Its IUPAC name is N-(2,5-diphenylpyrazolo[4,3-d]pyrimidin-7-yl)-N-(furan-2-carbonyl)furan-2-carboxamide.
| Compound Name | N-(2,5-diphenylpyrazolo[4,3-d]pyrimidin-7-yl)-N-(furan-2-carbonyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 71600100 |
| Molecular Formula | C27H17N5O4 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-(2,5-diphenylpyrazolo[4,3-d]pyrimidin-7-yl)-N-(furan-2-carbonyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(C(=O)c1ccco1)c1nc(-c2ccccc2)nc2cn(-c3ccccc3)nc12 |
| InChI | InChI=1S/C27H17N5O4/c33-26(21-13-7-15-35-21)32(27(34)22-14-8-16-36-22)25-23-20(17-31(30-23)19-11-5-2-6-12-19)28-24(29-25)18-9-3-1-4-10-18/h1-17H |
| InChIKey | ATZGHDIPHMJNDA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 107.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|