C35H19F4N7 — CID 139232030
3-[6-[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(4-fluorophenyl)-1,2,4-triazine (PubChem CID 139232030) has the molecular formula C35H19F4N7 and a molecular weight of 613.58 g/mol. Its IUPAC name is 3-[6-[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(4-fluorophenyl)-1,2,4-triazine.
| Compound Name | 3-[6-[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(4-fluorophenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 139232030 |
| Molecular Formula | C35H19F4N7 |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 3-[6-[5,6-bis(4-fluorophenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(4-fluorophenyl)-1,2,4-triazine |
| SMILES | Fc1ccc(-c2nnc(-c3cccc(-c4nnc(-c5ccc(F)cc5)c(-c5ccc(F)cc5)n4)n3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C35H19F4N7/c36-24-12-4-20(5-13-24)30-32(22-8-16-26(38)17-9-22)43-45-34(41-30)28-2-1-3-29(40-28)35-42-31(21-6-14-25(37)15-7-21)33(44-46-35)23-10-18-27(39)19-11-23/h1-19H |
| InChIKey | WOGJLUKYOXCIBQ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |