C25H23N5 — CID 6409933
5,6-diphenyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazine (PubChem CID 6409933) has the molecular formula C25H23N5 and a molecular weight of 393.49 g/mol. Its IUPAC name is 5,6-diphenyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazine.
| Compound Name | 5,6-diphenyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 6409933 |
| Molecular Formula | C25H23N5 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 5,6-diphenyl-3-(4-phenylpiperazin-1-yl)-1,2,4-triazine |
| SMILES | c1ccc(-c2nnc(N3CCN(c4ccccc4)CC3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N5/c1-4-10-20(11-5-1)23-24(21-12-6-2-7-13-21)27-28-25(26-23)30-18-16-29(17-19-30)22-14-8-3-9-15-22/h1-15H,16-19H2 |
| InChIKey | YYIDLQAYBASNCB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |