C27H21N5OS3 — CID 139233078
1-[[2-[(3-cyano-4-thiophen-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl)sulfanyl]acetyl]amino]-3-phenylthiourea (PubChem CID 139233078) has the molecular formula C27H21N5OS3 and a molecular weight of 527.70 g/mol. Its IUPAC name is 1-[[2-[(3-cyano-4-thiophen-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl)sulfanyl]acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-[(3-cyano-4-thiophen-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl)sulfanyl]acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 139233078 |
| Molecular Formula | C27H21N5OS3 |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 1-[[2-[(3-cyano-4-thiophen-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl)sulfanyl]acetyl]amino]-3-phenylthiourea |
| SMILES | N#Cc1c(SCC(=O)NNC(=S)Nc2ccccc2)nc2c(c1-c1cccs1)CCc1ccccc1-2 |
| InChI | InChI=1S/C27H21N5OS3/c28-15-21-24(22-11-6-14-35-22)20-13-12-17-7-4-5-10-19(17)25(20)30-26(21)36-16-23(33)31-32-27(34)29-18-8-2-1-3-9-18/h1-11,14H,12-13,16H2,(H,31,33)(H2,29,32,34) |
| InChIKey | QQQBXIOZENPIRR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|