C23H18ClN3O3S2 — CID 139233179
[5-(3-chloroanilino)-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-4-yl]-phenylmethanone (PubChem CID 139233179) has the molecular formula C23H18ClN3O3S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is [5-(3-chloroanilino)-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-4-yl]-phenylmethanone.
| Compound Name | [5-(3-chloroanilino)-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139233179 |
| Molecular Formula | C23H18ClN3O3S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | [5-(3-chloroanilino)-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-4-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C(=O)c3ccccc3)c(Nc3cccc(Cl)c3)[nH]c2=S)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S2/c1-15-10-12-19(13-11-15)32(29,30)27-20(21(28)16-6-3-2-4-7-16)22(26-23(27)31)25-18-9-5-8-17(24)14-18/h2-14,25H,1H3,(H,26,31) |
| InChIKey | JUQMSZOMDMHFLO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|