C24H19N3O5S2 — CID 139233181
4-[[4-benzoyl-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-5-yl]amino]benzoic acid (PubChem CID 139233181) has the molecular formula C24H19N3O5S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 4-[[4-benzoyl-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-5-yl]amino]benzoic acid.
| Compound Name | 4-[[4-benzoyl-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-5-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 139233181 |
| Molecular Formula | C24H19N3O5S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 4-[[4-benzoyl-3-(4-methylphenyl)sulfonyl-2-sulfanylidene-1H-imidazol-5-yl]amino]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C(=O)c3ccccc3)c(Nc3ccc(C(=O)O)cc3)[nH]c2=S)cc1 |
| InChI | InChI=1S/C24H19N3O5S2/c1-15-7-13-19(14-8-15)34(31,32)27-20(21(28)16-5-3-2-4-6-16)22(26-24(27)33)25-18-11-9-17(10-12-18)23(29)30/h2-14,25H,1H3,(H,26,33)(H,29,30) |
| InChIKey | VRZQNWGIPGRNJH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|