C25H20BrFeNS — CID 139234494
4-(4-bromophenyl)-2-cyclopenta-1,4-dien-1-yl-2,3-dihydro-1,5-benzothiazepine;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139234494) has the molecular formula C25H20BrFeNS and a molecular weight of 502.26 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-cyclopenta-1,4-dien-1-yl-2,3-dihydro-1,5-benzothiazepine;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 4-(4-bromophenyl)-2-cyclopenta-1,4-dien-1-yl-2,3-dihydro-1,5-benzothiazepine;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139234494 |
| Molecular Formula | C25H20BrFeNS |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | 4-(4-bromophenyl)-2-cyclopenta-1,4-dien-1-yl-2,3-dihydro-1,5-benzothiazepine;cyclopenta-1,3-diene;iron(2+) |
| SMILES | Brc1ccc(C2=Nc3ccccc3SC(c3cc[cH-]c3)C2)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C20H15BrNS.C5H5.Fe/c21-16-11-9-14(10-12-16)18-13-20(15-5-1-2-6-15)23-19-8-4-3-7-17(19)22-18;1-2-4-5-3-1;/h1-12,20H,13H2;1-5H;/q2*-1;+2 |
| InChIKey | UAWBETXUMKHFIY-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|