C52H54N4O2 — CID 139235423
(3S)-3-[3-[10-[3-[(3R)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]phenoxy]decoxy]phenyl]-2,5-diphenyl-3,4-dihydropyrazole (PubChem CID 139235423) has the molecular formula C52H54N4O2 and a molecular weight of 767.03 g/mol. Its IUPAC name is (3S)-3-[3-[10-[3-[(3R)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]phenoxy]decoxy]phenyl]-2,5-diphenyl-3,4-dihydropyrazole.
| Compound Name | (3S)-3-[3-[10-[3-[(3R)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]phenoxy]decoxy]phenyl]-2,5-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 139235423 |
| Molecular Formula | C52H54N4O2 |
| Molecular Weight | 767.03 g/mol |
| Exact Mass | 766.42 |
| IUPAC Name | (3S)-3-[3-[10-[3-[(3R)-2,5-diphenyl-3,4-dihydropyrazol-3-yl]phenoxy]decoxy]phenyl]-2,5-diphenyl-3,4-dihydropyrazole |
| SMILES | c1ccc(C2=NN(c3ccccc3)[C@@H](c3cccc(OCCCCCCCCCCOc4cccc([C@@H]5CC(c6ccccc6)=NN5c5ccccc5)c4)c3)C2)cc1 |
| InChI | InChI=1S/C52H54N4O2/c1(3-5-19-35-57-47-33-21-27-43(37-47)51-39-49(41-23-11-7-12-24-41)53-55(51)45-29-15-9-16-30-45)2-4-6-20-36-58-48-34-22-28-44(38-48)52-40-50(42-25-13-8-14-26-42)54-56(52)46-31-17-10-18-32-46/h7-18,21-34,37-38,51-52H,1-6,19-20,35-36,39-40H2/t51-,52+ |
| InChIKey | NQHONYXJYFTDQK-NZUCHVTOSA-N |
| XLogP | 12.98 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.03 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|