C11H12ClN3O2 — CID 139235810
ethyl 2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)propanoate (PubChem CID 139235810) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is ethyl 2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)propanoate.
| Compound Name | ethyl 2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)propanoate |
|---|---|
| PubChem CID | 139235810 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | ethyl 2-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)propanoate |
| SMILES | CCOC(=O)C(C)n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C11H12ClN3O2/c1-3-17-11(16)7(2)15-5-4-8-9(12)13-6-14-10(8)15/h4-7H,3H2,1-2H3 |
| InChIKey | KFMGHTCGGXDOHX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |