C19H23FeNO5 — CID 139238732
[[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139238732) has the molecular formula C19H23FeNO5 and a molecular weight of 401.24 g/mol. Its IUPAC name is [[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | [[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139238732 |
| Molecular Formula | C19H23FeNO5 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-cyclopenta-2,4-dien-1-ylidenemethanolate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC1(C)O[C@H]2O[C@H](CNC([O-])=C3C=CC=C3)[C@H](O)[C@H]2O1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C14H19NO5.C5H5.Fe/c1-14(2)19-11-10(16)9(18-13(11)20-14)7-15-12(17)8-5-3-4-6-8;1-2-4-5-3-1;/h3-6,9-11,13,15-17H,7H2,1-2H3;1-5H;/q;-1;+2/p-1/t9-,10+,11-,13-;;/m1../s1 |
| InChIKey | BZNRIQXDMRZGPT-VZSTWSIOSA-M |
| XLogP | 0.91 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|