C21H19F3FeN2O2 — CID 139239362
cyclopenta-1,3-diene;N-[1-(cyclopenta-1,4-dien-1-ylmethylamino)-1-oxopropan-2-yl]-3,4,5-trifluorobenzamide;iron(2+) (PubChem CID 139239362) has the molecular formula C21H19F3FeN2O2 and a molecular weight of 444.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;N-[1-(cyclopenta-1,4-dien-1-ylmethylamino)-1-oxopropan-2-yl]-3,4,5-trifluorobenzamide;iron(2+).
| Compound Name | cyclopenta-1,3-diene;N-[1-(cyclopenta-1,4-dien-1-ylmethylamino)-1-oxopropan-2-yl]-3,4,5-trifluorobenzamide;iron(2+) |
|---|---|
| PubChem CID | 139239362 |
| Molecular Formula | C21H19F3FeN2O2 |
| Molecular Weight | 444.23 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | cyclopenta-1,3-diene;N-[1-(cyclopenta-1,4-dien-1-ylmethylamino)-1-oxopropan-2-yl]-3,4,5-trifluorobenzamide;iron(2+) |
| SMILES | CC(NC(=O)c1cc(F)c(F)c(F)c1)C(=O)NCc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C16H14F3N2O2.C5H5.Fe/c1-9(15(22)20-8-10-4-2-3-5-10)21-16(23)11-6-12(17)14(19)13(18)7-11;1-2-4-5-3-1;/h2-7,9H,8H2,1H3,(H,20,22)(H,21,23);1-5H;/q2*-1;+2 |
| InChIKey | PCBLCVWPLKROSX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|