C20H17F3FeN2O2 — CID 139239378
cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-3,4,5-trifluorobenzamide;iron(2+) (PubChem CID 139239378) has the molecular formula C20H17F3FeN2O2 and a molecular weight of 430.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-3,4,5-trifluorobenzamide;iron(2+).
| Compound Name | cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-3,4,5-trifluorobenzamide;iron(2+) |
|---|---|
| PubChem CID | 139239378 |
| Molecular Formula | C20H17F3FeN2O2 |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-3,4,5-trifluorobenzamide;iron(2+) |
| SMILES | O=C(CNC(=O)c1cc(F)c(F)c(F)c1)NCc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C15H12F3N2O2.C5H5.Fe/c16-11-5-10(6-12(17)14(11)18)15(22)20-8-13(21)19-7-9-3-1-2-4-9;1-2-4-5-3-1;/h1-6H,7-8H2,(H,19,21)(H,20,22);1-5H;/q2*-1;+2 |
| InChIKey | BVNYFTFBFXHOGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|