C20H18F2FeN2O2 — CID 139239374
cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-2,4-difluorobenzamide;iron(2+) (PubChem CID 139239374) has the molecular formula C20H18F2FeN2O2 and a molecular weight of 412.22 g/mol. Its IUPAC name is cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-2,4-difluorobenzamide;iron(2+).
| Compound Name | cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-2,4-difluorobenzamide;iron(2+) |
|---|---|
| PubChem CID | 139239374 |
| Molecular Formula | C20H18F2FeN2O2 |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | cyclopenta-1,3-diene;N-[2-(cyclopenta-1,4-dien-1-ylmethylamino)-2-oxoethyl]-2,4-difluorobenzamide;iron(2+) |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1F)NCc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C15H13F2N2O2.C5H5.Fe/c16-11-5-6-12(13(17)7-11)15(21)19-9-14(20)18-8-10-3-1-2-4-10;1-2-4-5-3-1;/h1-7H,8-9H2,(H,18,20)(H,19,21);1-5H;/q2*-1;+2 |
| InChIKey | VDSOOGLGYWJQLP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|